Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A166095-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$352.90
|
|
Discover 3-Allyl-2-chloro-4-iodopyridine by Aladdin Scientific in for only $352.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1142192-13-9 | AKOS015838868 | 2-chloro-4-iodo-3-prop-2-enylpyridine | 3-Allyl-2-chloro-4-iodopyridine, AldrichCPR | MFCD11857736 | FT-0732338 | 2-chloro-4-iodo-3-(prop-2-en-1-yl)pyridine | 3-Allyl-2-chloro-4-iodopyridine | DTXSID90673929 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Polyhalopyridines |
| Alternative Parents | 2-halopyridines Aryl iodides Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - 2-halopyridine - Aryl iodide - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organoiodide - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polyhalopyridines. These are organic compounds containing a pyridine ring substituted at two or more positions by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-4-iodo-3-prop-2-enylpyridine |
|---|---|
| INCHI | InChI=1S/C8H7ClIN/c1-2-3-6-7(10)4-5-11-8(6)9/h2,4-5H,1,3H2 |
| InChIKey | XBNJCPXJPFDTDG-UHFFFAOYSA-N |
| Smiles | C=CCC1=C(C=CN=C1Cl)I |
| Isomeric SMILES | C=CCC1=C(C=CN=C1Cl)I |
| WGK Germany | 3 |
| PubChem CID | 46736860 |
| Molecular Weight | 279.51 |
| Molecular Weight | 279.500 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 278.931 Da |
| Monoisotopic Mass | 278.931 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |