Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D166472-250mg
|
250mg |
3
|
$85.90
|
|
|
D166472-1g
|
1g |
2
|
$263.90
|
|
| Synonyms | DTXSID30671085 | 3,7-Dibromoquinolin-4(1H)-one | 3,7-Dibromoquinolin-4-ol | 3,7-dibromo-1H-quinolin-4-one | 1203579-53-6 | MFCD13192872 | 3,7-Dibromo-4-hydroxyquinoline, AldrichCPR | 3,7-Dibromo-4-hydroxyquinoline |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Quinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hydroquinolones |
| Alternative Parents | Haloquinolines Hydroquinolines Pyridines and derivatives Benzenoids Aryl bromides Vinylogous amides Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Dihydroquinolone - Haloquinoline - Dihydroquinoline - Aryl bromide - Aryl halide - Pyridine - Benzenoid - Vinylogous amide - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as hydroquinolones. These are compounds containing a hydrogenated quinoline bearing a ketone group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504770612 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504770612 |
| IUPAC Name | 3,7-dibromo-1H-quinolin-4-one |
| INCHI | InChI=1S/C9H5Br2NO/c10-5-1-2-6-8(3-5)12-4-7(11)9(6)13/h1-4H,(H,12,13) |
| InChIKey | FCRKTWYWSKVPGU-UHFFFAOYSA-N |
| Smiles | C1=CC2=C(C=C1Br)NC=C(C2=O)Br |
| Isomeric SMILES | C1=CC2=C(C=C1Br)NC=C(C2=O)Br |
| WGK Germany | 3 |
| PubChem CID | 45599543 |
| Molecular Weight | 302.95 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 11, 2022 | D166472 | |
| Certificate of Analysis | Nov 11, 2022 | D166472 | |
| Certificate of Analysis | Nov 11, 2022 | D166472 |
| Molecular Weight | 302.950 g/mol |
|---|---|
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 302.872 Da |
| Monoisotopic Mass | 300.874 Da |
| Topological Polar Surface Area | 29.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |