Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D178543-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$102.90
|
|
|
D178543-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$316.90
|
|
|
D178543-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,423.90
|
|
|
D178543-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,562.90
|
|
| Synonyms | 3,6-DIBROMOPYRAZIN-2-AMINE | 957230-70-5 | 2-AMINO-3,6-DIBROMOPYRAZINE | 3,6-DIBROMOPYRAZINE-2-AMINE | MFCD11040377 | 3-Amino-2,5-dibromopyrazine | 3,6-dibromo-pyrazin-2-ylamine | 3,6-dibromo-2-pyrazinamine | SCHEMBL274632 | 3,6-dibromopyrazin-2-yl amine | DTXSID40679633 | ZED |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyrazines |
| Alternative Parents | Imidolactams Aryl bromides Heteroaromatic compounds Azacyclic compounds Primary amines Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminopyrazine - Imidolactam - Aryl halide - Aryl bromide - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organobromide - Organohalogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyrazines. These are organic compounds containing an amino group attached to a pyrazine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3,6-dibromopyrazin-2-amine |
|---|---|
| INCHI | InChI=1S/C4H3Br2N3/c5-2-1-8-3(6)4(7)9-2/h1H,(H2,7,9) |
| InChIKey | ZEDFFSRZLCREEN-UHFFFAOYSA-N |
| Smiles | C1=C(N=C(C(=N1)Br)N)Br |
| Isomeric SMILES | C1=C(N=C(C(=N1)Br)N)Br |
| Molecular Weight | 252.897 |
| Reaxy-Rn | 15599562 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15599562&ln= |
| Molecular Weight | 252.890 g/mol |
|---|---|
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 252.867 Da |
| Monoisotopic Mass | 250.869 Da |
| Topological Polar Surface Area | 51.800 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 99.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |