Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D184514-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$98.90
|
|
|
D184514-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$405.90
|
|
| Synonyms | 3,5-dimethylpyridin-4-amine | 43078-60-0 | 4-Amino-3,5-dimethylpyridine | 3,5-Dimethylpyridine-4-amine | MFCD03413657 | 4-PYRIDINAMINE, 3,5-DIMETHYL- | 3 pound not5-DIMETHYLPYRIDIN-4-AMINE | 3,5-dimethyl-4-pyridinamine | 3,5-dimethyl-4-aminopyridine | SCHEMBL1553320 | DTXSID |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Aminopyridines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyridines and derivatives |
| Alternative Parents | Methylpyridines Heteroaromatic compounds Azacyclic compounds Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylpyridine - Aminopyridine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyridines and derivatives. These are organic heterocyclic compounds containing an amino group attached to a pyridine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3,5-dimethylpyridin-4-amine |
|---|---|
| INCHI | InChI=1S/C7H10N2/c1-5-3-9-4-6(2)7(5)8/h3-4H,1-2H3,(H2,8,9) |
| InChIKey | QFLLABOTLITCPP-UHFFFAOYSA-N |
| Smiles | CC1=CN=CC(=C1N)C |
| Isomeric SMILES | CC1=CN=CC(=C1N)C |
| Molecular Weight | 122.2 |
| Reaxy-Rn | 471695 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=471695&ln= |
| Molecular Weight | 122.170 g/mol |
|---|---|
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 122.084 Da |
| Monoisotopic Mass | 122.084 Da |
| Topological Polar Surface Area | 38.900 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 82.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |