Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D185141-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$26.90
|
|
|
D185141-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$87.90
|
|
|
D185141-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$349.90
|
|
|
D185141-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,258.90
|
|
| Synonyms | 3,5-dichloro-4-methylaniline | 54730-35-7 | 3,5-dichloro-4-methyl aniline | benzenamine, 3,5-dichloro-4-methyl- | SCHEMBL1752160 | DTXSID30348861 | GTEUMCIATAHZFK-UHFFFAOYSA-N | CL8410 | MFCD00266300 | AKOS006238565 | AM82961 | CS-W021813 | GS-3988 | A7959 | FT-0686967 | EN300-55099 | J |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Aniline and substituted anilines Aminotoluenes Aryl chlorides Primary amines Organopnictogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminotoluene - Aniline or substituted anilines - 1,3-dichlorobenzene - Toluene - Aryl halide - Aryl chloride - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3,5-dichloro-4-methylaniline |
|---|---|
| INCHI | InChI=1S/C7H7Cl2N/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,10H2,1H3 |
| InChIKey | GTEUMCIATAHZFK-UHFFFAOYSA-N |
| Smiles | CC1=C(C=C(C=C1Cl)N)Cl |
| Isomeric SMILES | CC1=C(C=C(C=C1Cl)N)Cl |
| Molecular Weight | 176 |
| Reaxy-Rn | 2963472 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2963472&ln= |
| Molecular Weight | 176.040 g/mol |
|---|---|
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 174.996 Da |
| Monoisotopic Mass | 174.996 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 106.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |