Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D353134-1g
|
1g |
6
|
$64.90
|
|
|
D353134-5g
|
5g |
5
|
$248.90
|
|
| Synonyms | DTXSID40363469 | 3,5-Dibromo-2-methoxybenzaldehyde, 97% | MFCD02093682 | Z55992887 | BBL009385 | InChI=1/C8H6Br2O2/c1-12-8-5(4-11)2-6(9)3-7(8)10/h2-4H,1H | SCHEMBL1071145 | FT-0640771 | A833351 | F82642 | NJFNLMDSRHQQNR-UHFFFAOYSA-N | EN300-08964 | STK198 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoyl derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoyl derivatives |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Benzaldehydes Anisoles Bromobenzenes Alkyl aryl ethers Aryl bromides Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Benzaldehyde - Benzoyl - Methoxybenzene - Phenol ether - Alkyl aryl ether - Bromobenzene - Halobenzene - Aryl-aldehyde - Aryl halide - Aryl bromide - Ether - Organic oxygen compound - Aldehyde - Hydrocarbon derivative - Organic oxide - Organohalogen compound - Organobromide - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoyl derivatives. These are organic compounds containing an acyl moiety of benzoic acid with the formula (C6H5CO-). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488191860 |
|---|---|
| IUPAC Name | 3,5-dibromo-2-methoxybenzaldehyde |
| INCHI | InChI=1S/C8H6Br2O2/c1-12-8-5(4-11)2-6(9)3-7(8)10/h2-4H,1H3 |
| InChIKey | NJFNLMDSRHQQNR-UHFFFAOYSA-N |
| Smiles | COC1=C(C=C(C=C1Br)Br)C=O |
| Isomeric SMILES | COC1=C(C=C(C=C1Br)Br)C=O |
| Molecular Weight | 293.95 |
| Reaxy-Rn | 3250322 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3250322&ln= |
| Melt Point(°C) | 93 -96° C |
|---|---|
| Molecular Weight | 293.940 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 293.871 Da |
| Monoisotopic Mass | 291.873 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 163.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |