Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M734254-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$130.90
|
|
| Specifications & Purity | ≥98% |
|---|
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylethers |
| Alternative Parents | Phenylpyrrolidines Diarylethers Phenoxy compounds Phenol ethers Chlorobenzenes 1,3-dicarbonyl compounds Pyrrolidine-3-ones Pyrrolidine-2-ones Aryl chlorides N-alkylpyrrolidines Tertiary carboxylic acid amides Pyrroles Tertiary amines Amino acids and derivatives Cyclic ketones Lactams Azacyclic compounds Organic oxides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Diphenylether - Diaryl ether - 3-phenylpyrrolidine - Phenoxy compound - Phenol ether - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - N-alkylpyrrolidine - 1,3-dicarbonyl compound - 3-pyrrolidone - 2-pyrrolidone - Pyrrolidone - Tertiary carboxylic acid amide - Pyrrole - Pyrrolidine - Carboxamide group - Ketone - Lactam - Cyclic ketone - Amino acid or derivatives - Tertiary amine - Organoheterocyclic compound - Ether - Azacycle - Carboxylic acid derivative - Organohalogen compound - Organic oxygen compound - Amine - Organic oxide - Organochloride - Organonitrogen compound - Organooxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylethers. These are aromatic compounds containing two benzene rings linked to each other through an ether group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-(5-chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione |
|---|---|
| INCHI | InChI=1S/C17H14ClNO3/c1-19-10-14(20)16(17(19)21)13-9-11(18)7-8-15(13)22-12-5-3-2-4-6-12/h2-9,16H,10H2,1H3 |
| InChIKey | LAXTYFZLKJOGDP-UHFFFAOYSA-N |
| Smiles | CN1CC(=O)C(C1=O)C2=C(C=CC(=C2)Cl)OC3=CC=CC=C3 |
| Isomeric SMILES | CN1CC(=O)C(C1=O)C2=C(C=CC(=C2)Cl)OC3=CC=CC=C3 |
| PubChem CID | 57826927 |
| Molecular Weight | 315.75 |
| Molecular Weight | 315.700 g/mol |
|---|---|
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 315.066 Da |
| Monoisotopic Mass | 315.066 Da |
| Topological Polar Surface Area | 46.600 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 436.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |