Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A637871-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,401.90
|
|
| Synonyms | 3-[4-(Trifluoromethoxy)phenyl]azetidine Hydrochloride | 3-[4-(trifluoromethoxy)phenyl]azetidine;hydrochloride | PS-18731 | SB51910 | 3-(4-(Trifluoromethoxy)phenyl)azetidinehydrochloride | GS0582 | MFCD27922377 | 3-(4-(Trifluoromethoxy)phenyl)azetidine hyd |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Phenylazetidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylazetidines |
| Alternative Parents | Phenoxy compounds Phenol ethers Aralkylamines Trihalomethanes Dialkylamines Azacyclic compounds Organooxygen compounds Organofluorides Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 3-phenylazetidine - Phenoxy compound - Phenol ether - Aralkylamine - Monocyclic benzene moiety - Benzenoid - Trihalomethane - Secondary aliphatic amine - Secondary amine - Azacycle - Alkyl halide - Halomethane - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Organic nitrogen compound - Hydrocarbon derivative - Amine - Hydrochloride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylazetidines. These are polycyclic aromatic compounds containing a phenyl ring substituted with an azetidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-[4-(trifluoromethoxy)phenyl]azetidine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C10H10F3NO.ClH/c11-10(12,13)15-9-3-1-7(2-4-9)8-5-14-6-8;/h1-4,8,14H,5-6H2;1H |
| InChIKey | MPIIIDIAWDXKSN-UHFFFAOYSA-N |
| Smiles | C1C(CN1)C2=CC=C(C=C2)OC(F)(F)F.Cl |
| Isomeric SMILES | C1C(CN1)C2=CC=C(C=C2)OC(F)(F)F.Cl |
| Alternate CAS | 1956331-83-1 |
| PubChem CID | 72698851 |
| Molecular Weight | 253.650 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 253.048 Da |
| Monoisotopic Mass | 253.048 Da |
| Topological Polar Surface Area | 21.300 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 207.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |