Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F165777-1g
|
1g |
10
|
$85.90
|
|
|
F165777-5g
|
5g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$295.90
|
|
| Synonyms | 1072952-03-4 | (3-((4-Fluorobenzyl)oxy)phenyl)boronic acid | 3-(4'-Fluorobenzyloxy)phenylboronic acid | [3-[(4-fluorophenyl)methoxy]phenyl]boronic acid | {3-[(4-Fluorophenyl)methoxy]phenyl}boronic acid | MFCD08705238 | SCHEMBL459524 | DTXSID70584802 | AKOS009318759 | AS-55 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Fluorobenzenes Alkyl aryl ethers Aryl fluorides Boronic acids Organic metalloid salts Organofluorides Organoboron compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Halobenzene - Fluorobenzene - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Boronic acid derivative - Boronic acid - Organic metalloid salt - Ether - Organic oxygen compound - Organohalogen compound - Organoboron compound - Organofluoride - Organooxygen compound - Organic salt - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504768324 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768324 |
| IUPAC Name | [3-[(4-fluorophenyl)methoxy]phenyl]boronic acid |
| INCHI | InChI=1S/C13H12BFO3/c15-12-6-4-10(5-7-12)9-18-13-3-1-2-11(8-13)14(16)17/h1-8,16-17H,9H2 |
| InChIKey | WSTWPQWJAKLITI-UHFFFAOYSA-N |
| Smiles | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)F)(O)O |
| Isomeric SMILES | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)F)(O)O |
| WGK Germany | 3 |
| Molecular Weight | 246.04 |
| Reaxy-Rn | 21263063 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=21263063&ln= |
| Melt Point(°C) | 140-144°C |
|---|---|
| Molecular Weight | 246.040 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 246.086 Da |
| Monoisotopic Mass | 246.086 Da |
| Topological Polar Surface Area | 49.700 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 244.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |