Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D467481-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$41.90
|
|
|
D467481-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$135.90
|
|
|
D467481-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$61.90
|
|
| Synonyms | F72595 | 3,4-Dimethoxybenzenesulfonyl fluoride, 95% | VS-0081 | 3,4-dimethoxybenzene-1-sulfonylfluoride | 3,4-dimethoxybenzene-1-sulfonyl fluoride | EN300-728607 | AKOS022542768 | 3,4-DIMETHOXYBENZENESULFONYL FLUORIDE |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
| Product Description |
Description Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Methoxybenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dimethoxybenzenes |
| Alternative Parents | Benzenesulfonyl compounds Phenoxy compounds Anisoles Alkyl aryl ethers Sulfonyls Sulfonyl fluorides Organosulfonic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | O-dimethoxybenzene - Dimethoxybenzene - Benzenesulfonyl group - Phenoxy compound - Anisole - Phenol ether - Alkyl aryl ether - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl fluoride - Sulfonyl halide - Sulfonyl - Ether - Hydrocarbon derivative - Organosulfur compound - Organic oxygen compound - Organic oxide - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3,4-dimethoxybenzenesulfonyl fluoride |
|---|---|
| INCHI | InChI=1S/C8H9FO4S/c1-12-7-4-3-6(14(9,10)11)5-8(7)13-2/h3-5H,1-2H3 |
| InChIKey | LCEVVNNKUAEPJM-UHFFFAOYSA-N |
| Smiles | COC1=C(C=C(C=C1)S(=O)(=O)F)OC |
| Isomeric SMILES | COC1=C(C=C(C=C1)S(=O)(=O)F)OC |
| UN Number | 3261 |
| Molecular Weight | 220.22 |
| Reaxy-Rn | 5004116 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5004116&ln= |
| Sensitivity | Moisture sensitive |
|---|---|
| Flash Point(°F) | Not applicable |
| Flash Point(°C) | Not applicable |
| Melt Point(°C) | 59-63℃ |
| Molecular Weight | 220.220 g/mol |
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 220.021 Da |
| Monoisotopic Mass | 220.021 Da |
| Topological Polar Surface Area | 61.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 272.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |