Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D185607-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,741.90
|
|
Discover 3,4-Dichloro-2-methylaniline by Aladdin Scientific in 95% for only $2,741.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3,4-Dichloro-2-methylaniline | 62077-25-2 | Benzenamine, 3,4-dichloro-2-methyl- | 6-Amino-2,3-dichlorotoluene | SCHEMBL8282372 | DTXSID40606984 | MFCD11855814 | AKOS006343559 | BS-23015 | CS-0211700 | C90779 | A868564 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Aniline and substituted anilines Aminotoluenes Aryl chlorides Primary amines Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminotoluene - Aniline or substituted anilines - 1,2-dichlorobenzene - Toluene - Aryl halide - Aryl chloride - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3,4-dichloro-2-methylaniline |
|---|---|
| INCHI | InChI=1S/C7H7Cl2N/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,10H2,1H3 |
| InChIKey | NMIWDZYCBUCFON-UHFFFAOYSA-N |
| Smiles | CC1=C(C=CC(=C1Cl)Cl)N |
| Isomeric SMILES | CC1=C(C=CC(=C1Cl)Cl)N |
| Molecular Weight | 176 |
| Reaxy-Rn | 2085702 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2085702&ln= |
| Molecular Weight | 176.040 g/mol |
|---|---|
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 174.996 Da |
| Monoisotopic Mass | 174.996 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 118.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |