Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C180908-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,132.90
|
|
| Synonyms | 1261970-06-2 | 3'-Fluoro-5-methoxy-[1,1'-biphenyl]-3,4'-dicarboxylic acid | 3-(4-CARBOXY-3-FLUOROPHENYL)-5-METHOXYBENZOIC ACID | 4-(3-carboxy-5-methoxyphenyl)-2-fluorobenzoic acid | 3/'-Fluoro-5-Methoxy-[1,1/'-biphenyl]-3,4/'-dicarboxylic acid | DTXSID10690936 | 3'-F |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Biphenyls and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Biphenyls and derivatives |
| Alternative Parents | M-methoxybenzoic acids and derivatives 2-halobenzoic acids Halobenzoic acids Benzoic acids 1-carboxy-2-haloaromatic compounds Phenoxy compounds Methoxybenzenes Anisoles Benzoyl derivatives Alkyl aryl ethers Fluorobenzenes Aryl fluorides Vinylogous halides Hydrocarbon derivatives Organic oxides Organofluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Biphenyl - M-methoxybenzoic acid or derivatives - 2-halobenzoic acid or derivatives - Halobenzoic acid or derivatives - Halobenzoic acid - 2-halobenzoic acid - Benzoic acid or derivatives - Benzoic acid - Anisole - Phenoxy compound - Benzoyl - Phenol ether - 1-carboxy-2-haloaromatic compound - Methoxybenzene - Halobenzene - Fluorobenzene - Alkyl aryl ether - Aryl fluoride - Aryl halide - Vinylogous halide - Ether - Carboxylic acid - Carboxylic acid derivative - Organohalogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organofluoride - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as biphenyls and derivatives. These are organic compounds containing to benzene rings linked together by a C-C bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(3-carboxy-5-methoxyphenyl)-2-fluorobenzoic acid |
|---|---|
| INCHI | InChI=1S/C15H11FO5/c1-21-11-5-9(4-10(6-11)14(17)18)8-2-3-12(15(19)20)13(16)7-8/h2-7H,1H3,(H,17,18)(H,19,20) |
| InChIKey | XSOSNMBMBVAPKW-UHFFFAOYSA-N |
| Smiles | COC1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)C(=O)O)F |
| Isomeric SMILES | COC1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)C(=O)O)F |
| PubChem CID | 53227380 |
| Molecular Weight | 290.2 |
| Molecular Weight | 290.240 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Exact Mass | 290.059 Da |
| Monoisotopic Mass | 290.059 Da |
| Topological Polar Surface Area | 83.800 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 400.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |