Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D172643-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,888.90
|
|
| Synonyms | 1214900-72-7 | 3,3-dimethyl-6-nitro-2,3-dihydro-1H-isoindol-1-one | 3,3-dimethyl-6-nitroisoindolin-1-one | 3,3-Dimethyl-6-nitro-2,3-dihydro-isoindol-1-one | 3,3-dimethyl-6-nitro-2H-isoindol-1-one | SCHEMBL2144836 | LQWDYKNVIZRQSN-UHFFFAOYSA-N | DTXSID701227604 | MFCD2839 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Isoindoles and derivatives |
| Subclass | Isoindolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isoindolones |
| Alternative Parents | Isoindoles Nitroaromatic compounds Benzenoids Secondary carboxylic acid amides Lactams Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic zwitterions Organic salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isoindolone - Isoindole - Nitroaromatic compound - Benzenoid - Carboxamide group - Lactam - C-nitro compound - Secondary carboxylic acid amide - Organic nitro compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic oxoazanium - Carboxylic acid derivative - Organic 1,3-dipolar compound - Azacycle - Organic oxide - Organic zwitterion - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic salt - Organic oxygen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as isoindolones. These are aromatic polycyclic compounds that an isoindole bearing a ketone. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3,3-dimethyl-6-nitro-2H-isoindol-1-one |
|---|---|
| INCHI | InChI=1S/C10H10N2O3/c1-10(2)8-4-3-6(12(14)15)5-7(8)9(13)11-10/h3-5H,1-2H3,(H,11,13) |
| InChIKey | LQWDYKNVIZRQSN-UHFFFAOYSA-N |
| Smiles | CC1(C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)N1)C |
| Isomeric SMILES | CC1(C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)N1)C |
| Molecular Weight | 206.201 |
| Reaxy-Rn | 20139793 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=20139793&ln= |
| Molecular Weight | 206.200 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 206.069 Da |
| Monoisotopic Mass | 206.069 Da |
| Topological Polar Surface Area | 74.900 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 308.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |