Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R174391-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,503.90
|
|
Discover [(2R)-2-methylpyrrolidin-2-yl]methanol hydrochloride by Aladdin Scientific in 97% for only $3,503.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1523530-30-4 | (R)-(2-Methylpyrrolidin-2-yl)methanol hydrochloride | [(2R)-2-METHYLPYRROLIDIN-2-YL]METHANOL HYDROCHLORIDE | 1408057-43-1 | (2R)-2-Methylpyrrolidine-2-methanol HCl | [(2R)-2-methylpyrrolidin-2-yl]methanol;hydrochloride | (2R)-2-Methylpyrrolidine-2-Meth |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolidines |
| Alternative Parents | 1,2-aminoalcohols Dialkylamines Azacyclic compounds Primary alcohols Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Pyrrolidine - 1,2-aminoalcohol - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Primary alcohol - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolidines. These are compounds containing a pyrrolidine ring, which is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [(2R)-2-methylpyrrolidin-2-yl]methanol;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H13NO.ClH/c1-6(5-8)3-2-4-7-6;/h7-8H,2-5H2,1H3;1H/t6-;/m1./s1 |
| InChIKey | FFTQTMXKUQODRT-FYZOBXCZSA-N |
| Smiles | CC1(CCCN1)CO.Cl |
| Isomeric SMILES | C[C@@]1(CCCN1)CO.Cl |
| PubChem CID | 91825932 |
| Molecular Weight | 151.63 |
| Molecular Weight | 151.630 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 151.076 Da |
| Monoisotopic Mass | 151.076 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 84.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |