Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H173798-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,985.90
|
|
| Synonyms | 1385696-70-7 | 4-ethyloxan-4-amine hydrochloride | 4-Ethyltetrahydro-2H-pyran-4-amine hydrochloride | 4-Ethyltetrahydro-2H-pyran-4-amine HCl | 4-ethyloxan-4-amine;hydrochloride | MFCD22418725 | 2H-Pyran-4-amine, 4-ethyltetrahydro-, hydrochloride (1:1) | AKOS026741247 | A |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Oxanes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Oxanes |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxane - Oxacycle - Ether - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as oxanes. These are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-ethyloxan-4-amine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H15NO.ClH/c1-2-7(8)3-5-9-6-4-7;/h2-6,8H2,1H3;1H |
| InChIKey | XAYXHPWEBURGOE-UHFFFAOYSA-N |
| Smiles | CCC1(CCOCC1)N.Cl |
| Isomeric SMILES | CCC1(CCOCC1)N.Cl |
| PubChem CID | 71757570 |
| Molecular Weight | 165.66 |
| Molecular Weight | 165.660 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 165.092 Da |
| Monoisotopic Mass | 165.092 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 86.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |