Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P179234-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$40.90
|
|
| Synonyms | 1072952-34-1 | (2-Methylpyridin-3-yl)boronic acid hydrochloride | 2-PICOLINE-3-BORONIC ACID HCL | 2-Methylpyridine-3-boronic acid hydrochloride | 2-Picoline-3-boronic acid hydrochloride | (2-methylpyridin-3-yl)boronic acid;hydrochloride | 2-Methylpyridine-3-boronic a |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Methylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylpyridines |
| Alternative Parents | Heteroaromatic compounds Boronic acids Organic metalloid salts Azacyclic compounds Organonitrogen compounds Organometalloid compounds Organic oxygen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylpyridine - Heteroaromatic compound - Boronic acid - Boronic acid derivative - Azacycle - Organic metalloid salt - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organic metalloid moeity - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methylpyridines. These are organic compounds containing a pyridine ring substituted at one or more positions by a methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2-methylpyridin-3-yl)boronic acid;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H8BNO2.ClH/c1-5-6(7(9)10)3-2-4-8-5;/h2-4,9-10H,1H3;1H |
| InChIKey | OAMCCRLFDPJOPN-UHFFFAOYSA-N |
| Smiles | B(C1=C(N=CC=C1)C)(O)O.Cl |
| Isomeric SMILES | B(C1=C(N=CC=C1)C)(O)O.Cl |
| PubChem CID | 44119808 |
| Molecular Weight | 173.4 |
| Molecular Weight | 173.410 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 173.041 Da |
| Monoisotopic Mass | 173.041 Da |
| Topological Polar Surface Area | 53.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 110.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |