Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P169344-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$327.90
|
|
| Synonyms | 2-phenyladamantan-2-ol | 29480-18-0 | ChemDiv3_000567 | 2-Phenyl-2-adamantanol # | Oprea1_851100 | Adamantan-2-ol, 2-phenyl- | SCHEMBL6896759 | 2-PHENYL-ADAMANTAN-2-OL | DTXSID10341219 | FSVUOZUVEZBKGB-UHFFFAOYSA-N | HMS1474J17 | MFCD00230988 | AKOS001484810 | NCGC00172733-01 | LS-0 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | Tertiary alcohols Cyclic alcohols and derivatives Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Monocyclic benzene moiety - Tertiary alcohol - Cyclic alcohol - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Alcohol - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-phenyladamantan-2-ol |
|---|---|
| INCHI | InChI=1S/C16H20O/c17-16(13-4-2-1-3-5-13)14-7-11-6-12(9-14)10-15(16)8-11/h1-5,11-12,14-15,17H,6-10H2 |
| InChIKey | FSVUOZUVEZBKGB-UHFFFAOYSA-N |
| Smiles | C1C2CC3CC1CC(C2)C3(C4=CC=CC=C4)O |
| Isomeric SMILES | C1C2CC3CC1CC(C2)C3(C4=CC=CC=C4)O |
| PubChem CID | 571171 |
| Molecular Weight | 228.337 |
| Molecular Weight | 228.330 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 228.151 Da |
| Monoisotopic Mass | 228.151 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 275.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |