Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P178566-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$4,670.90
|
|
Discover 2-phenyl-2,6-diazaspiro[3.3]heptan-1-one by Aladdin Scientific in 97% for only $4,670.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-phenyl-2,6-diazaspiro[3.3]heptan-1-one | 960079-47-4 | 2-phenyl-2,6-diazaspiro[3.3]heptan-3-one | DTXSID70735110 | MFCD13180714 | AKOS015950355 | PB18041 | AS-34757 | CS-0000702 | FT-0686013 | 2-Phenyl-2,6-diazaspiro-[3.3]heptan-1-one | A858726 | J-510249 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Phenylazetidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylazetidines |
| Alternative Parents | Benzene and substituted derivatives Tertiary carboxylic acid amides Beta lactams Tertiary amines Amino acids and derivatives Dialkylamines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1-phenylazetidine - Monocyclic benzene moiety - Benzenoid - Beta-lactam - Tertiary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Tertiary amine - Lactam - Azacycle - Secondary amine - Carboxylic acid derivative - Secondary aliphatic amine - Amine - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylazetidines. These are polycyclic aromatic compounds containing a phenyl ring substituted with an azetidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-phenyl-2,6-diazaspiro[3.3]heptan-3-one |
|---|---|
| INCHI | InChI=1S/C11H12N2O/c14-10-11(6-12-7-11)8-13(10)9-4-2-1-3-5-9/h1-5,12H,6-8H2 |
| InChIKey | JGOYKNYAYFJVST-UHFFFAOYSA-N |
| Smiles | C1C2(CN1)CN(C2=O)C3=CC=CC=C3 |
| Isomeric SMILES | C1C2(CN1)CN(C2=O)C3=CC=CC=C3 |
| PubChem CID | 66521755 |
| Molecular Weight | 188.23 |
| Molecular Weight | 188.230 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 188.095 Da |
| Monoisotopic Mass | 188.095 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 254.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |