Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P170474-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$52.90
|
|
Discover 2-Phenoxyacetohydrazide by Aladdin Scientific in for only $52.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Phenoxyacetohydrazide | 4664-55-5 | Phenoxyacetic acid hydrazide | Acetic acid, phenoxy-, hydrazide | Phenoxy-Acetic Acid Hydrazide | MFCD00297030 | PC 603 | NSC-409846 | Maybridge4_003484 | 2-Phenoxyacetohydrazide # | PHENOXYACETOHYDRAZIDE | Cambridge id 5153128 | Oprea1_3097 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Alkyl aryl ethers Carboxylic acid hydrazides Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Monocyclic benzene moiety - Carboxylic acid hydrazide - Carboxylic acid derivative - Ether - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Carbonyl group - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-phenoxyacetohydrazide |
|---|---|
| INCHI | InChI=1S/C8H10N2O2/c9-10-8(11)6-12-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11) |
| InChIKey | XSONSBDQIFBIOY-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)OCC(=O)NN |
| Isomeric SMILES | C1=CC=C(C=C1)OCC(=O)NN |
| PubChem CID | 101390 |
| Molecular Weight | 166.18 |
| Molecular Weight | 166.180 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 166.074 Da |
| Monoisotopic Mass | 166.074 Da |
| Topological Polar Surface Area | 64.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 144.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |