Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
O631455-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$312.90
|
|
|
O631455-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$499.90
|
|
|
O631455-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$833.90
|
|
|
O631455-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,501.90
|
|
| Synonyms | EN300-27717618 | [(1s,4s)-2-oxabicyclo[2.1.1]hexan-1-yl]methanol | 2-Oxabicyclo[2.1.1]hexan-1-ylmethanol | CS-0310284 | {2-oxabicyclo[2.1.1]hexan-1-yl}methanol | BS-45678 | AT20086 | (2-OXABICYCLO[2.1.1]HEXAN-1-YL)METHANOL | EN300-329105 | 2060007-65-8 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Tetrahydrofurans |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetrahydrofurans |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Tetrahydrofuran - Oxacycle - Ether - Dialkyl ether - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Alcohol - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetrahydrofurans. These are heterocyclic compounds containing a saturated, aliphatic, five-membered ring where a carbon is replaced by an oxygen. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-oxabicyclo[2.1.1]hexan-1-ylmethanol |
|---|---|
| INCHI | InChI=1S/C6H10O2/c7-4-6-1-5(2-6)3-8-6/h5,7H,1-4H2 |
| InChIKey | DISAAIHTGSBMRS-UHFFFAOYSA-N |
| Smiles | C1C2CC1(OC2)CO |
| Isomeric SMILES | C1C2CC1(OC2)CO |
| Alternate CAS | 2060007-65-8 |
| PubChem CID | 125449602 |
| Molecular Weight | 114.14 |
| Molecular Weight | 114.140 g/mol |
|---|---|
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 114.068 Da |
| Monoisotopic Mass | 114.068 Da |
| Topological Polar Surface Area | 29.500 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 105.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |