Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
O178144-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$107.90
|
|
Discover 2-oxa-5-azabicyclo[2.2.1]heptane hydrochloride by Aladdin Scientific in 97% for only $107.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-oxa-5-azabicyclo[2.2.1]heptane hydrochloride | 909186-56-7 | 2-OXA-5-AZABICYCLO[2.2.1]HEPTANE HCL | 2-oxa-5-aza-bicyclo[2.2.1]heptane hydrochloride | 2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride | MFCD07798642 | SCHEMBL16829 | DTXSID40619998 | ZFOKPFPITUUCJX-UHFFFAOY |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Oxazinanes |
| Subclass | Morpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Morpholines |
| Alternative Parents | Pyrrolidines Oxolanes Oxacyclic compounds Dialkylamines Dialkyl ethers Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Morpholine - Oxolane - Pyrrolidine - Dialkyl ether - Secondary aliphatic amine - Ether - Secondary amine - Azacycle - Oxacycle - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Amine - Hydrochloride - Organic nitrogen compound - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as morpholines. These are organic compounds containing a morpholine moiety, which consists of a six-member aliphatic saturated ring with the formula C4H9NO, where the oxygen and nitrogen atoms lie at positions 1 and 4, respectively. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride |
|---|---|
| INCHI | InChI=1S/C5H9NO.ClH/c1-4-3-7-5(1)2-6-4;/h4-6H,1-3H2;1H |
| InChIKey | ZFOKPFPITUUCJX-UHFFFAOYSA-N |
| Smiles | C1C2CNC1CO2.Cl |
| Isomeric SMILES | C1C2CNC1CO2.Cl |
| Molecular Weight | 135.592 |
| Reaxy-Rn | 14609365 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14609365&ln= |
| Molecular Weight | 135.590 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 135.045 Da |
| Monoisotopic Mass | 135.045 Da |
| Topological Polar Surface Area | 21.300 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 84.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |