Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N159489-1g
|
1g |
3
|
$13.90
|
|
| Synonyms | MFCD00001152 | BRN 2052959 | J-018205 | 2-Nitrofluorenon | CCRIS 2540 | 9-Fluorenone, 2-nitro | DTXSID70184942 | 2-Nitro-9H-fluoren-9-one # | SCHEMBL229511 | 2-Nitro-9-fluorenone | 2-Nitro-9H-fluoren-9-one | NSC 12365 | InChI=1/C13H7NO3/c15-13-11-4-2-1-3- |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Fluorenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorenes |
| Alternative Parents | Nitroaromatic compounds Aryl ketones Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Fluorene - Nitroaromatic compound - Aryl ketone - Ketone - C-nitro compound - Organic nitro compound - Organic oxoazanium - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorenes. These are compounds containing a fluorene moiety, which consists of two benzene rings connected through either a cyclopentane, cyclopentene, or cyclopenta-1,3-diene. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504752883 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504752883 |
| IUPAC Name | 2-nitrofluoren-9-one |
| INCHI | InChI=1S/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
| InChIKey | AJEAHBZZHSLIQP-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)[N+](=O)[O-] |
| Isomeric SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)[N+](=O)[O-] |
| WGK Germany | 3 |
| RTECS | LL9091000 |
| Molecular Weight | 225.2 |
| Beilstein | 7(3)2344 |
| Reaxy-Rn | 2052959 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2052959&ln= |
| Melt Point(°C) | 222 °C |
|---|---|
| Molecular Weight | 225.200 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 225.043 Da |
| Monoisotopic Mass | 225.043 Da |
| Topological Polar Surface Area | 62.900 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 349.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |