Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N168257-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
| Synonyms | 2-Naphthoylmethyl thiocyanate | 19339-62-9 | 1-(Naphthalen-2-yl)-2-thiocyanatoethanone | 2-(2-Naphthyl)-2-oxoethyl thiocyanate | Thiocyanic acid, 2-naphthoylmethyl ester | (2-naphthalen-2-yl-2-oxoethyl) thiocyanate | Thiocyanic acid, 2-(2-naphthalenyl)-2-oxoethyl est |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Aryl alkyl ketones Thiocyanates Sulfenyl compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthalene - Aryl alkyl ketone - Aryl ketone - Ketone - Sulfenyl compound - Thiocyanate - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) thiocyanate |
|---|---|
| INCHI | InChI=1S/C13H9NOS/c14-9-16-8-13(15)12-6-5-10-3-1-2-4-11(10)7-12/h1-7H,8H2 |
| InChIKey | FGMSBOSKVIWYEW-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C=C(C=CC2=C1)C(=O)CSC#N |
| Isomeric SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CSC#N |
| Molecular Weight | 227.287 |
| Reaxy-Rn | 2645976 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2645976&ln= |
| Molecular Weight | 227.280 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 227.04 Da |
| Monoisotopic Mass | 227.04 Da |
| Topological Polar Surface Area | 66.200 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 306.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |