Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N468500-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$726.90
|
|
| Synonyms | HY-Y0110S1 | SCHEMBL13915068 | (~2~H_7_)Naphthalen-2-ol | 1,3,4,5,6,7,8-heptadeuterionaphthalen-2-ol | DTXSID30583912 | D99463 | 2-Naphthol-1,3,4,5,6,7,8-d7, 97 atom % D | AKOS015912813 | (?H?)naphthalen-2-ol | 2-Naphthol-1,3,4,5,6,7,8-d7 | 2-naphthol-d7 |
|---|---|
| Specifications & Purity | ≥97 atom% D |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Naphthols and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthols and derivatives |
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | 2-naphthol - 1-hydroxy-2-unsubstituted benzenoid - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthols and derivatives. These are naphthalene derivatives carrying one or more hydroxyl (-OH) groups at any ring position. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,3,4,5,6,7,8-heptadeuterionaphthalen-2-ol |
|---|---|
| INCHI | InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H/i1D,2D,3D,4D,5D,6D,7D |
| InChIKey | JWAZRIHNYRIHIV-GSNKEKJESA-N |
| Smiles | C1=CC=C2C=C(C=CC2=C1)O |
| Isomeric SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])O)[2H])[2H])[2H] |
| UN Number | 3077 |
| Molecular Weight | 151.21 |
| Reaxy-Rn | 742134 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=742134&ln= |
| Flash Point(°F) | Not applicable |
|---|---|
| Flash Point(°C) | Not applicable |
| Boil Point(°C) | 285-286℃ (lit.) |
| Melt Point(°C) | 120-122℃ (lit.) |
| Molecular Weight | 151.210 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 151.101 Da |
| Monoisotopic Mass | 151.101 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 133.000 |
| Isotope Atom Count | 7 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |