Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M178160-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,534.90
|
|
| Synonyms | 91188-26-0 | 2-Methyl-2,7-diazaspiro[4.4]nonane dihydrochloride | 2,7-Diazaspiro[4.4]nonane, 2-methyl-, dihydrochloride | 2-methyl-2,7-diazaspiro[4.4]nonane;dihydrochloride | 2-METHYL-2,7-DIAZASPIRO[4.4]NONANE 2HCL | MFCD13185105 | 2-METHYL-2,7-DIAZASPIRO[4.4]NONANED |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazaspirononane derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diazaspirononane derivatives |
| Alternative Parents | N-alkylpyrrolidines Trialkylamines Dialkylamines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Diazaspirononane - N-alkylpyrrolidine - Pyrrolidine - Tertiary aliphatic amine - Tertiary amine - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as diazaspirononane derivatives. These are organic heterocyclic compounds that contain a nine-membered saturated bicyclic moiety, consisting of two aliphatic saturated rings in a spiro-configuration, each of which contain a nitrogen atom. The bicyclic moiety is made up of two nitrogen and seven carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-methyl-2,7-diazaspiro[4.4]nonane;dihydrochloride |
|---|---|
| INCHI | InChI=1S/C8H16N2.2ClH/c1-10-5-3-8(7-10)2-4-9-6-8;;/h9H,2-7H2,1H3;2*1H |
| InChIKey | KTWQBDFIDPFQKG-UHFFFAOYSA-N |
| Smiles | CN1CCC2(C1)CCNC2.Cl.Cl |
| Isomeric SMILES | CN1CCC2(C1)CCNC2.Cl.Cl |
| PubChem CID | 13491806 |
| Molecular Weight | 213.148 |
| Molecular Weight | 213.150 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 212.085 Da |
| Monoisotopic Mass | 212.085 Da |
| Topological Polar Surface Area | 15.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 135.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |