Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M180079-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,456.90
|
|
Discover 2-Methoxy-6-(4-(trifluoromethyl)phenyl)pyridine by Aladdin Scientific in 95% for only $2,456.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Methoxy-6-(4-(trifluoromethyl)phenyl)pyridine | 1202026-99-0 | 2-methoxy-6-[4-(trifluoromethyl)phenyl]pyridine | 4-(6-Methoxypyridin-2-yl)benzotrifluoride | DTXSID40716557 | QLUISBKTHWCQPO-UHFFFAOYSA-N | MFCD18421599 | AKOS015892206 | BS-25676 | CS-0208836 | A892303 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Phenylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyridines |
| Alternative Parents | Trifluoromethylbenzenes Alkyl aryl ethers Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-phenylpyridine - Trifluoromethylbenzene - Alkyl aryl ether - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Azacycle - Ether - Hydrocarbon derivative - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Alkyl halide - Alkyl fluoride - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-methoxy-6-[4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| INCHI | InChI=1S/C13H10F3NO/c1-18-12-4-2-3-11(17-12)9-5-7-10(8-6-9)13(14,15)16/h2-8H,1H3 |
| InChIKey | QLUISBKTHWCQPO-UHFFFAOYSA-N |
| Smiles | COC1=CC=CC(=N1)C2=CC=C(C=C2)C(F)(F)F |
| Isomeric SMILES | COC1=CC=CC(=N1)C2=CC=C(C=C2)C(F)(F)F |
| Molecular Weight | 253.2 |
| Reaxy-Rn | 19982262 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=19982262&ln= |
| Molecular Weight | 253.220 g/mol |
|---|---|
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 253.071 Da |
| Monoisotopic Mass | 253.071 Da |
| Topological Polar Surface Area | 22.100 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 261.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |