Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M185265-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$474.90
|
|
Discover 2-Methanesulfonyl-3-nitropyridine by Aladdin Scientific in 98% for only $474.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(methylsulfonyl)-3-nitropyridine | 56825-29-7 | 2-methanesulfonyl-3-nitropyridine | 2-methylsulfonyl-3-nitropyridine | MFCD16140367 | DTXSID80481671 | AC6375 | AKOS005072295 | CE-0737 | SY237457 | CS-0081762 | FT-0681866 | A869837 | J-506472 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Class | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | Pyridines and derivatives Sulfones Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organonitrogen compounds Organic salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Pyridine - Sulfone - Sulfonyl - Heteroaromatic compound - Organic oxoazanium - Azacycle - Organoheterocyclic compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organonitrogen compound - Organic salt - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organosulfur compound - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-methylsulfonyl-3-nitropyridine |
|---|---|
| INCHI | InChI=1S/C6H6N2O4S/c1-13(11,12)6-5(8(9)10)3-2-4-7-6/h2-4H,1H3 |
| InChIKey | STJMXSFTAWNECC-UHFFFAOYSA-N |
| Smiles | CS(=O)(=O)C1=C(C=CC=N1)[N+](=O)[O-] |
| Isomeric SMILES | CS(=O)(=O)C1=C(C=CC=N1)[N+](=O)[O-] |
| Molecular Weight | 202.2 |
| Reaxy-Rn | 1460323 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1460323&ln= |
| Molecular Weight | 202.190 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 202.005 Da |
| Monoisotopic Mass | 202.005 Da |
| Topological Polar Surface Area | 101.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 289.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |