Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F181590-5g
|
5g |
2
|
$51.90
|
|
|
F181590-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$230.90
|
|
|
F181590-100g
|
100g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$831.90
|
|
| Synonyms | 2-fluor-3-nitropyridine | AKOS005255936 | BCP22086 | 2-Fluoro-3-nitropyridine, AldrichCPR | F0982 | AS-14963 | AC-6000 | EN300-41103 | DTXSID40376478 | MFCD03095068 | QDKIYDGHCFZBGC-UHFFFAOYSA-N | AM20070258 | Pyridine, 2-fluoro-3-nitro- | SCHEMBL251800 | |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Class | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | 2-halopyridines Aryl fluorides Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - 2-halopyridine - Aryl fluoride - Aryl halide - Pyridine - Heteroaromatic compound - Organic oxoazanium - Propargyl-type 1,3-dipolar organic compound - Organoheterocyclic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Organonitrogen compound - Organofluoride - Organic oxygen compound - Organohalogen compound - Organic oxide - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488193304 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488193304 |
| IUPAC Name | 2-fluoro-3-nitropyridine |
| INCHI | InChI=1S/C5H3FN2O2/c6-5-4(8(9)10)2-1-3-7-5/h1-3H |
| InChIKey | QDKIYDGHCFZBGC-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(N=C1)F)[N+](=O)[O-] |
| Isomeric SMILES | C1=CC(=C(N=C1)F)[N+](=O)[O-] |
| Molecular Weight | 142.1 |
| Reaxy-Rn | 124475 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=124475&ln= |
| Solubility | Slightly soluble in water. |
|---|---|
| Sensitivity | air sensitive |
| Refractive Index | 1.53 |
| Flash Point(°C) | 104 °C |
| Boil Point(°C) | 110 °C/10 mmHg |
| Melt Point(°C) | 18 °C |
| Molecular Weight | 142.090 g/mol |
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 142.018 Da |
| Monoisotopic Mass | 142.018 Da |
| Topological Polar Surface Area | 58.700 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 136.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |