Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D172932-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,518.90
|
|
| Synonyms | 1250443-61-8 | 2-(DIPHENYLMETHYL)-2,6-DIAZASPIRO[3.4]OCTANE | 2-Benzhydryl-2,6-diazaspiro[3.4]octane | 2-benzhydryl-2,7-diazaspiro[3.4]octane | 2,6-Diazaspiro[3.4]octane, 2-(diphenylmethyl)- | DTXSID801258472 | MFCD16987815 | AKOS027325992 | PB30152 | AS-51131 | CS-0052233 | P |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Aralkylamines Pyrrolidines Trialkylamines Azetidines Dialkylamines Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Diphenylmethane - Aralkylamine - Pyrrolidine - Tertiary aliphatic amine - Tertiary amine - Azetidine - Azacycle - Organoheterocyclic compound - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-benzhydryl-2,7-diazaspiro[3.4]octane |
|---|---|
| INCHI | InChI=1S/C19H22N2/c1-3-7-16(8-4-1)18(17-9-5-2-6-10-17)21-14-19(15-21)11-12-20-13-19/h1-10,18,20H,11-15H2 |
| InChIKey | SYMQBAASXLKRNK-UHFFFAOYSA-N |
| Smiles | C1CNCC12CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
| Isomeric SMILES | C1CNCC12CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
| Molecular Weight | 278.399 |
| Reaxy-Rn | 38258059 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=38258059&ln= |
| Molecular Weight | 278.400 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 278.178 Da |
| Monoisotopic Mass | 278.178 Da |
| Topological Polar Surface Area | 15.300 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 317.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |