Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D129166-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$139.90
|
|
|
D129166-1g
|
1g |
2
|
$299.90
|
|
| Synonyms | SC11682 | SCHEMBL2720536 | N-[[6-(ditert-butylphosphanylmethyl)pyridin-2-yl]methyl]-N-ethylethanamine | N-({6-[(Di-tert-butylphosphanyl)methyl]pyridin-2-yl}methyl)-N-ethylethanamine | MFCD11656080 | 2-((Di-tert-butylphosphinomethyl)-6-diethylaminomethyl)p |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | 2-pyridylmethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 6-substituted-2-pyridinylmethylamines |
| Alternative Parents | Aralkylamines Heteroaromatic compounds Trialkylamines Organic phosphines and derivatives Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 6-substituted-2-pyridinylmethylamine - Aralkylamine - Heteroaromatic compound - Tertiary aliphatic amine - Tertiary amine - Phosphine - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organophosphorus compound - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 6-substituted-2-pyridinylmethylamines. These are aromatic heterocyclic compounds contaning a pyridine ring which is substituted at the 2-position with a methylamine, and at the 6-position with any non-hydrogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-[[6-(ditert-butylphosphanylmethyl)pyridin-2-yl]methyl]-N-ethylethanamine |
|---|---|
| INCHI | InChI=1S/C19H35N2P/c1-9-21(10-2)14-16-12-11-13-17(20-16)15-22(18(3,4)5)19(6,7)8/h11-13H,9-10,14-15H2,1-8H3 |
| InChIKey | MTBWGMDPQBSPGF-UHFFFAOYSA-N |
| Smiles | CCN(CC)CC1=NC(=CC=C1)CP(C(C)(C)C)C(C)(C)C |
| Isomeric SMILES | CCN(CC)CC1=NC(=CC=C1)CP(C(C)(C)C)C(C)(C)C |
| WGK Germany | 3 |
| Molecular Weight | 322.47 |
| Reaxy-Rn | 10176246 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10176246&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 25, 2024 | D129166 | |
| Certificate of Analysis | Jan 25, 2024 | D129166 | |
| Certificate of Analysis | Jan 25, 2024 | D129166 | |
| Certificate of Analysis | Jan 25, 2024 | D129166 |
| Sensitivity | Moisture sensitive |
|---|---|
| Refractive Index | 1.519 |
| Molecular Weight | 322.500 g/mol |
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 8 |
| Exact Mass | 322.254 Da |
| Monoisotopic Mass | 322.254 Da |
| Topological Polar Surface Area | 16.100 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 298.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |