Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C184978-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,566.90
|
|
Discover 2-(Cyclopropylamino)nicotinonitrile by Aladdin Scientific in 98% for only $1,566.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(cyclopropylamino)nicotinonitrile | 52583-90-1 | 2-(cyclopropylamino)pyridine-3-carbonitrile | 2-Cyclopropylamino-nicotinonitrile | SCHEMBL4535545 | 2-Cyclopropylaminonicotinonitrile | DTXSID60467817 | NQVWMXLKPISDFN-UHFFFAOYSA-N | BBL012472 | MFCD09455268 | STK501320 | AKOS |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | 3-pyridinecarbonitriles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 3-pyridinecarbonitriles |
| Alternative Parents | Aminopyridines and derivatives Imidolactams Heteroaromatic compounds Nitriles Azacyclic compounds Hydrocarbon derivatives Amines |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 3-pyridinecarbonitrile - Aminopyridine - Imidolactam - Heteroaromatic compound - Azacycle - Nitrile - Carbonitrile - Organic nitrogen compound - Cyanide - Hydrocarbon derivative - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 3-pyridinecarbonitriles. These are organic compounds containing a pyridine ring substituted at the 3-position by a carbonitrile group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(cyclopropylamino)pyridine-3-carbonitrile |
|---|---|
| INCHI | InChI=1S/C9H9N3/c10-6-7-2-1-5-11-9(7)12-8-3-4-8/h1-2,5,8H,3-4H2,(H,11,12) |
| InChIKey | NQVWMXLKPISDFN-UHFFFAOYSA-N |
| Smiles | C1CC1NC2=C(C=CC=N2)C#N |
| Isomeric SMILES | C1CC1NC2=C(C=CC=N2)C#N |
| Molecular Weight | 159.2 |
| Reaxy-Rn | 390119 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=390119&ln= |
| Molecular Weight | 159.190 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 159.08 Da |
| Monoisotopic Mass | 159.08 Da |
| Topological Polar Surface Area | 48.700 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |