Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C153943-1g
|
1g |
2
|
$70.90
|
|
|
C153943-5g
|
5g |
1
|
$269.90
|
|
| Synonyms | AS-59450 | AKOS009106825 | MFCD00041033 | alpha-Chlorocycloheptanone | BRN 1099282 | EN300-26518 | T71318 | CYCLOHEPTANONE, 2-CHLORO- | 2-Chlorocycloheptanone | DTXSID30883348 | Z223607164 | 2-Chlorocycloheptanone, AldrichCPR | 4-07-00-00040 (Beilstein Ha |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Alpha-haloketones |
| Direct Parent | Alpha-chloroketones |
| Alternative Parents | Cyclic ketones Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Alpha-chloroketone - Cyclic ketone - Organic oxide - Hydrocarbon derivative - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha-chloroketones. These are organic compounds contaning a chlorine atom attached to the alpha carbon atom relative to C=O group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504752415 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504752415 |
| IUPAC Name | 2-chlorocycloheptan-1-one |
| INCHI | InChI=1S/C7H11ClO/c8-6-4-2-1-3-5-7(6)9/h6H,1-5H2 |
| InChIKey | SDSZGDVXUFWFAA-UHFFFAOYSA-N |
| Smiles | C1CCC(C(=O)CC1)Cl |
| Isomeric SMILES | C1CCC(C(=O)CC1)Cl |
| Molecular Weight | 146.61 |
| Reaxy-Rn | 1099282 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1099282&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 14, 2023 | C153943 | |
| Certificate of Analysis | Aug 14, 2023 | C153943 | |
| Certificate of Analysis | Aug 14, 2023 | C153943 | |
| Certificate of Analysis | Aug 14, 2023 | C153943 |
| Sensitivity | Air Sensitive,Heat Sensitive |
|---|---|
| Refractive Index | 1.49 |
| Flash Point(°C) | 105 °C |
| Molecular Weight | 146.610 g/mol |
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 146.05 Da |
| Monoisotopic Mass | 146.05 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 111.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |