Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C178024-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,503.90
|
|
Discover 2-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine by Aladdin Scientific in 97% for only $3,503.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine | 889447-20-5 | SCHEMBL650607 | JYAUQLBWOPEZFN-UHFFFAOYSA-N | DTXSID701272930 | MFCD12755891 | AKOS024260309 | PB25471 | AS-33593 | CS-0051924 | FT-0705524 | A861376 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyrazines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyrazines |
| Alternative Parents | Substituted pyrroles Pyrazines Aryl iodides Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyrazine - Substituted pyrrole - Pyrazine - Aryl iodide - Aryl halide - Aryl chloride - Heteroaromatic compound - Pyrrole - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organoiodide - Organochloride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyrazines. These are compounds containing a pyrrolopyrazine moiety, which consists of a pyrrole ring fused to a pyrazine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyrazine is a 6-membered ring consisting of six carbon atoms and two nitrogen centers at ring positions 1 and 4. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| INCHI | InChI=1S/C6H3ClIN3/c7-4-2-10-6-5(11-4)3(8)1-9-6/h1-2H,(H,9,10) |
| InChIKey | JYAUQLBWOPEZFN-UHFFFAOYSA-N |
| Smiles | C1=C(C2=NC(=CN=C2N1)Cl)I |
| Isomeric SMILES | C1=C(C2=NC(=CN=C2N1)Cl)I |
| Molecular Weight | 279.47 |
| Reaxy-Rn | 14556553 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14556553&ln= |
| Molecular Weight | 279.460 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 278.906 Da |
| Monoisotopic Mass | 278.906 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 157.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |