Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C478968-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$595.90
|
|
| Synonyms | MFCD02741774 | Oprea1_766516 | 2-Chloro-6-ethoxyquinoline-3-methanol, AldrichCPR | Oprea1_146445 | (2-chloro-6-ethoxyquinolin-3-yl)methanol | AKOS000731943 | DTXSID10357714 | 2-Chloro-6-ethoxyquinoline-3-methanol |
|---|---|
| Specifications & Purity | Reagent grade |
| Legal Information | Product of BioBlocks |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Haloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chloroquinolines |
| Alternative Parents | Alkyl aryl ethers 2-halopyridines Benzenoids Aryl chlorides Heteroaromatic compounds Azacyclic compounds Primary alcohols Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chloroquinoline - Alkyl aryl ether - 2-halopyridine - Aryl chloride - Aryl halide - Pyridine - Benzenoid - Heteroaromatic compound - Ether - Azacycle - Alcohol - Aromatic alcohol - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chloroquinolines. These are compounds containing a quinoline moiety, which carries one or more chlorine atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2-chloro-6-ethoxyquinolin-3-yl)methanol |
|---|---|
| INCHI | InChI=1S/C12H12ClNO2/c1-2-16-10-3-4-11-8(6-10)5-9(7-15)12(13)14-11/h3-6,15H,2,7H2,1H3 |
| InChIKey | RTHYLIJSULORHP-UHFFFAOYSA-N |
| Smiles | CCOC1=CC2=CC(=C(N=C2C=C1)Cl)CO |
| Isomeric SMILES | CCOC1=CC2=CC(=C(N=C2C=C1)Cl)CO |
| WGK Germany | 3 |
| Molecular Weight | 237.68 |
| Reaxy-Rn | 19382545 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=19382545&ln= |
| Molecular Weight | 237.680 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 237.056 Da |
| Monoisotopic Mass | 237.056 Da |
| Topological Polar Surface Area | 42.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |