Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C178827-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,219.90
|
|
Discover 2-Chloro-6-(4-methoxybenzyloxy)pyridine by Aladdin Scientific in 98% for only $2,219.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-CHLORO-6-(4-METHOXYBENZYLOXY)PYRIDINE | 1020253-23-9 | 2-chloro-6-[(4-methoxyphenyl)methoxy]pyridine | DTXSID40674406 | VQB25323 | MFCD09972200 | AKOS012896202 | BS-19196 | A896922 | Pyridine, 2-chloro-6-[(4-methoxyphenyl)methoxy]- |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Alkyl aryl ethers 2-halopyridines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Alkyl aryl ether - 2-halopyridine - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Pyridine - Heteroaromatic compound - Ether - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-6-[(4-methoxyphenyl)methoxy]pyridine |
|---|---|
| INCHI | InChI=1S/C13H12ClNO2/c1-16-11-7-5-10(6-8-11)9-17-13-4-2-3-12(14)15-13/h2-8H,9H2,1H3 |
| InChIKey | KZADIUOCLPMBGX-UHFFFAOYSA-N |
| Smiles | COC1=CC=C(C=C1)COC2=NC(=CC=C2)Cl |
| Isomeric SMILES | COC1=CC=C(C=C1)COC2=NC(=CC=C2)Cl |
| Molecular Weight | 249.7 |
| Reaxy-Rn | 35918005 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=35918005&ln= |
| Molecular Weight | 249.690 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 249.056 Da |
| Monoisotopic Mass | 249.056 Da |
| Topological Polar Surface Area | 31.400 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 219.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |