Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C171874-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$11.90
|
|
|
C171874-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$37.90
|
|
| Synonyms | 1061358-78-8 | 2-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-4-AMINE | 6-chloro-3-trifluoromethylpyridin-4-ylamine | 2-CHLORO-5-TRIFLUOROMETHYL-PYRIDIN-4-YLAMINE | 4-Amino-2-chloro-5-(trifluoromethyl)pyridine | MFCD16658126 | SCHEMBL1230870 | DTXSID601263465 | AKOS022178828 | AB7143 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Aminopyridines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyridines and derivatives |
| Alternative Parents | 2-halopyridines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Primary amines Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminopyridine - 2-halopyridine - Aryl chloride - Aryl halide - Heteroaromatic compound - Azacycle - Alkyl fluoride - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Primary amine - Hydrocarbon derivative - Organic nitrogen compound - Amine - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyridines and derivatives. These are organic heterocyclic compounds containing an amino group attached to a pyridine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-5-(trifluoromethyl)pyridin-4-amine |
|---|---|
| INCHI | InChI=1S/C6H4ClF3N2/c7-5-1-4(11)3(2-12-5)6(8,9)10/h1-2H,(H2,11,12) |
| InChIKey | BVKYVDJDCQLPEC-UHFFFAOYSA-N |
| Smiles | C1=C(C(=CN=C1Cl)C(F)(F)F)N |
| Isomeric SMILES | C1=C(C(=CN=C1Cl)C(F)(F)F)N |
| Molecular Weight | 196.56 |
| Reaxy-Rn | 18473079 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18473079&ln= |
| Molecular Weight | 196.560 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 196.002 Da |
| Monoisotopic Mass | 196.002 Da |
| Topological Polar Surface Area | 38.900 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 161.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |