Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C586842-250mg
|
250mg |
3
|
$63.90
|
|
|
C586842-1g
|
1g |
2
|
$208.90
|
|
|
C586842-5g
|
5g |
1
|
$936.90
|
|
| Synonyms | 2-CHLORO-5-(TRIFLUOROMETHYL)PYRIDINE-4-CARBONITRILE | BS-14777 | 2-chloro-5-(trifluoromethyl)isonicotinonitrile | OKPDZBFTNATSFA-UHFFFAOYSA-N | 1260782-19-1 | SCHEMBL19844883 | s11330 | MFCD11848361 | AKOS027344890 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-halopyridines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Nitriles Azacyclic compounds Organopnictogen compounds Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-halopyridine - Aryl chloride - Aryl halide - Heteroaromatic compound - Carbonitrile - Nitrile - Azacycle - Alkyl fluoride - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Hydrocarbon derivative - Cyanide - Organopnictogen compound - Organic nitrogen compound - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-halopyridines. These are organic compounds containing a pyridine ring substituted at the 2-position by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504771232 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771232 |
| IUPAC Name | 2-chloro-5-(trifluoromethyl)pyridine-4-carbonitrile |
| INCHI | InChI=1S/C7H2ClF3N2/c8-6-1-4(2-12)5(3-13-6)7(9,10)11/h1,3H |
| InChIKey | OKPDZBFTNATSFA-UHFFFAOYSA-N |
| Smiles | C1=C(C(=CN=C1Cl)C(F)(F)F)C#N |
| Isomeric SMILES | C1=C(C(=CN=C1Cl)C(F)(F)F)C#N |
| Molecular Weight | 206.55 |
| Reaxy-Rn | 32469038 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=32469038&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 14, 2023 | C586842 | |
| Certificate of Analysis | Sep 14, 2023 | C586842 | |
| Certificate of Analysis | Sep 14, 2023 | C586842 | |
| Certificate of Analysis | Sep 14, 2023 | C586842 | |
| Certificate of Analysis | Sep 14, 2023 | C586842 | |
| Certificate of Analysis | Sep 14, 2023 | C586842 |
| Molecular Weight | 206.550 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 205.986 Da |
| Monoisotopic Mass | 205.986 Da |
| Topological Polar Surface Area | 36.700 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |