Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C177524-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$123.90
|
|
| Synonyms | 2-CHLORO-5-ETHOXYPYRIMIDINE | 82153-68-2 | 2-CHLORO-5-ETHOXY-PYRIMIDINE | MFCD10697651 | SCHEMBL160948 | DTXSID10574348 | QFRSOKNULFUQDS-UHFFFAOYSA-N | AKOS006305790 | PB17760 | AS-34323 | SY097735 | CS-0051956 | FT-0717610 | A864452 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | 2-halopyrimidines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-halopyrimidine - Halopyrimidine - Alkyl aryl ether - Pyrimidine - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-5-ethoxypyrimidine |
|---|---|
| INCHI | InChI=1S/C6H7ClN2O/c1-2-10-5-3-8-6(7)9-4-5/h3-4H,2H2,1H3 |
| InChIKey | QFRSOKNULFUQDS-UHFFFAOYSA-N |
| Smiles | CCOC1=CN=C(N=C1)Cl |
| Isomeric SMILES | CCOC1=CN=C(N=C1)Cl |
| Molecular Weight | 158.59 |
| Reaxy-Rn | 122569 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=122569&ln= |
| Molecular Weight | 158.580 g/mol |
|---|---|
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 158.025 Da |
| Monoisotopic Mass | 158.025 Da |
| Topological Polar Surface Area | 35.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 93.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |