Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C173981-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,285.90
|
|
Discover 2-chloro-5-[(1-methylpiperidin-4-yl)methoxy]pyrimidine by Aladdin Scientific in 97% for only $1,285.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1408074-71-4 | 2-Chloro-5-(1-methyl-piperidin-4-ylmethoxy)-pyrimidine | 2-chloro-5-[(1-methylpiperidin-4-yl)methoxy]pyrimidine | MFCD23105890 | 2-chloro-5-((1-methylpiperidin-4-yl)methoxy)pyrimidine | Pyrimidine, 2-chloro-5-[(1-methyl-4-piperidinyl)methoxy]- | DTXSID |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | 2-halopyrimidines Piperidines Aryl chlorides Heteroaromatic compounds Trialkylamines Azacyclic compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl aryl ether - 2-halopyrimidine - Halopyrimidine - Aryl chloride - Aryl halide - Piperidine - Pyrimidine - Heteroaromatic compound - Tertiary amine - Tertiary aliphatic amine - Organoheterocyclic compound - Azacycle - Organic nitrogen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-5-[(1-methylpiperidin-4-yl)methoxy]pyrimidine |
|---|---|
| INCHI | InChI=1S/C11H16ClN3O/c1-15-4-2-9(3-5-15)8-16-10-6-13-11(12)14-7-10/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | KOJCOLTUVIRIGR-UHFFFAOYSA-N |
| Smiles | CN1CCC(CC1)COC2=CN=C(N=C2)Cl |
| Isomeric SMILES | CN1CCC(CC1)COC2=CN=C(N=C2)Cl |
| PubChem CID | 72208009 |
| Molecular Weight | 241.72 |
| Molecular Weight | 241.720 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 241.098 Da |
| Monoisotopic Mass | 241.098 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |