Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C183680-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,088.90
|
|
Discover 2-Chloro-4-thiocyanatoaniline by Aladdin Scientific in 97% for only $2,088.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-CHLORO-4-THIOCYANATOANILINE | 3226-47-9 | 4-Amino-3-chlorophenyl thiocyanate | (4-amino-3-chlorophenyl) thiocyanate | 2-chloro-4-thiocyanato-aniline | [(4-amino-3-chlorophenyl)sulfanyl]formonitrile | Thiocyanic acid,4-amino-3-chlorophenyl ester | SCHEMBL7979164 | DTXSI |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Class | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl thioethers |
| Alternative Parents | Aniline and substituted anilines Chlorobenzenes Aryl chlorides Thiocyanates Sulfenyl compounds Primary amines Organopnictogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aryl thioether - Aniline or substituted anilines - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Thiocyanate - Sulfenyl compound - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Organopnictogen compound - Organic nitrogen compound - Amine - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl thioethers. These are organosulfur compounds containing a thioether group that is substituted by an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (4-amino-3-chlorophenyl) thiocyanate |
|---|---|
| INCHI | InChI=1S/C7H5ClN2S/c8-6-3-5(11-4-9)1-2-7(6)10/h1-3H,10H2 |
| InChIKey | TZBOJMWJGHBCEV-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1SC#N)Cl)N |
| Isomeric SMILES | C1=CC(=C(C=C1SC#N)Cl)N |
| Molecular Weight | 184.6 |
| Reaxy-Rn | 2804470 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2804470&ln= |
| Molecular Weight | 184.650 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 183.986 Da |
| Monoisotopic Mass | 183.986 Da |
| Topological Polar Surface Area | 75.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 177.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |