Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B299814-1g
|
1g |
2
|
$196.90
|
|
| Synonyms | 2-Chloro-4,6-dimethylphenyl isocyanate | 124421-12-1 | 1-chloro-2-isocyanato-3,5-dimethylbenzene | Benzene, 1-chloro-2-isocyanato-3,5-dimethyl- | 2-CHLORO-4 6-DIMETHYLPHENYL ISOCYANATE | SCHEMBL3839590 | DTXSID30402639 | GRPKAFNBYGDGCX-UHFFFAOYSA-N | AS-80087 | 2-Chloro-4, |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Xylenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | m-Xylenes |
| Alternative Parents | Chlorobenzenes Aryl chlorides Isocyanates Propargyl-type 1,3-dipolar organic compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | M-xylene - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Isocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as m-xylenes. These are aromatic compounds that contain a m-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 3-positions. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504762993 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504762993 |
| IUPAC Name | 1-chloro-2-isocyanato-3,5-dimethylbenzene |
| INCHI | InChI=1S/C9H8ClNO/c1-6-3-7(2)9(11-5-12)8(10)4-6/h3-4H,1-2H3 |
| InChIKey | GRPKAFNBYGDGCX-UHFFFAOYSA-N |
| Smiles | CC1=CC(=C(C(=C1)Cl)N=C=O)C |
| Isomeric SMILES | CC1=CC(=C(C(=C1)Cl)N=C=O)C |
| WGK Germany | 3 |
| Molecular Weight | 181.62 |
| Reaxy-Rn | 3540476 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3540476&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 12, 2023 | B299814 |
| Sensitivity | Moisture sensitive |
|---|---|
| Melt Point(°C) | 23-27 °C |
| Molecular Weight | 181.620 g/mol |
| XLogP3 | 4.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 181.029 Da |
| Monoisotopic Mass | 181.029 Da |
| Topological Polar Surface Area | 29.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |