Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C170771-25g
|
25g |
3
|
$26.90
|
|
|
C170771-100g
|
100g |
1
|
$95.90
|
|
| Synonyms | NSC 89737 | CCA19674 | EINECS 257-728-9 | 2-Chloro-1,4-diethoxybenzene | F87348 | NSC89737 | NSC-89737 | SCHEMBL3786617 | AS-59440 | 2,5-Diethoxy-1-chlorobenzene | A871048 | 1-Chloro-2,5-Diethoxybenzene | ZIMKMIAIVORSSX-UHFFFAOYSA-N | InChI=1/C10H13ClO2/c |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Chlorobenzenes Alkyl aryl ethers Aryl chlorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Halobenzene - Chlorobenzene - Alkyl aryl ether - Monocyclic benzene moiety - Aryl halide - Aryl chloride - Ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488183322 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488183322 |
| IUPAC Name | 2-chloro-1,4-diethoxybenzene |
| INCHI | InChI=1S/C10H13ClO2/c1-3-12-8-5-6-10(13-4-2)9(11)7-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | ZIMKMIAIVORSSX-UHFFFAOYSA-N |
| Smiles | CCOC1=CC(=C(C=C1)OCC)Cl |
| Isomeric SMILES | CCOC1=CC(=C(C=C1)OCC)Cl |
| Molecular Weight | 200.66 |
| Reaxy-Rn | 3257093 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3257093&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 26, 2023 | C170771 | |
| Certificate of Analysis | Jun 26, 2023 | C170771 | |
| Certificate of Analysis | Jun 26, 2023 | C170771 | |
| Certificate of Analysis | Jun 26, 2023 | C170771 |
| Flash Point(°C) | 130 °C |
|---|---|
| Boil Point(°C) | 266 °C |
| Molecular Weight | 200.660 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 200.06 Da |
| Monoisotopic Mass | 200.06 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |