Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C589321-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$146.90
|
|
| Synonyms | EN300-295778 | alpha-(Chloromethyl)-3,4-difluorobenzenemethanol | AKOS017517782 | C8H7ClF2O | DTXSID601259298 | BS-53076 | SB37433 | BCP18012 | SB30071 | SB31792 | 2-Chloro-1-(3,4-difluorophenyl)ethanol | 2-Chloro-1-(3,4-difluoro-phenyl)-ethanol | SCHEMBL |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides Secondary alcohols Chlorohydrins Organofluorides Organochlorides Hydrocarbon derivatives Aromatic alcohols Alkyl chlorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Fluorobenzene - Aryl fluoride - Aryl halide - Chlorohydrin - Halohydrin - Secondary alcohol - Organochloride - Organohalogen compound - Alkyl chloride - Aromatic alcohol - Alcohol - Hydrocarbon derivative - Organic oxygen compound - Organofluoride - Organooxygen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-1-(3,4-difluorophenyl)ethanol |
|---|---|
| INCHI | InChI=1S/C8H7ClF2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,12H,4H2 |
| InChIKey | RYOLLNVCYSUXCP-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1C(CCl)O)F)F |
| Isomeric SMILES | C1=CC(=C(C=C1C(CCl)O)F)F |
| Molecular Weight | 192.59 |
| Reaxy-Rn | 2415525 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2415525&ln= |
| Molecular Weight | 192.590 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 192.015 Da |
| Monoisotopic Mass | 192.015 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 145.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |