Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B194780-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$656.90
|
|
Discover 2-Bromothieno[2,3-b]pyridine by Aladdin Scientific in 98% for only $656.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Bromothieno[2,3-b]pyridine | 72808-92-5 | SCHEMBL12266347 | DTXSID90729218 | MFCD20528122 | AKOS022173787 | CS-0455305 | EN300-6996467 | A866197 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Thienopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thienopyridines |
| Alternative Parents | 2,3,5-trisubstituted thiophenes Pyridines and derivatives Aryl bromides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Thienopyridine - 2,3,5-trisubstituted thiophene - Pyridine - Aryl halide - Aryl bromide - Heteroaromatic compound - Thiophene - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organobromide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as thienopyridines. These are heterocyclic compounds containing a thiophene ring fused to a pyridine ring. Thiophene is 5-membered ring consisting of four carbon atoms and one sulfur atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-bromothieno[2,3-b]pyridine |
|---|---|
| INCHI | InChI=1S/C7H4BrNS/c8-6-4-5-2-1-3-9-7(5)10-6/h1-4H |
| InChIKey | UAMUSRIEEHYHBP-UHFFFAOYSA-N |
| Smiles | C1=CC2=C(N=C1)SC(=C2)Br |
| Isomeric SMILES | C1=CC2=C(N=C1)SC(=C2)Br |
| Molecular Weight | 214.08 |
| Reaxy-Rn | 32204712 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=32204712&ln= |
| Molecular Weight | 214.080 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 212.925 Da |
| Monoisotopic Mass | 212.925 Da |
| Topological Polar Surface Area | 41.100 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 131.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |