Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B194667-250mg
|
250mg |
3
|
$12.90
|
|
|
B194667-1g
|
1g |
3
|
$39.90
|
|
|
B194667-5g
|
5g |
3
|
$106.90
|
|
|
B194667-25g
|
25g |
2
|
$322.90
|
|
|
B194667-100g
|
100g |
1
|
$1,159.90
|
|
| Synonyms | 700381-18-6 | 2-(bromomethyl)-4-fluoro-1-methoxybenzene | 5-Fluoro-2-methoxybenzyl bromide | 2-bromomethyl-4-fluoro-1-methoxybenzene | MFCD00671769 | 2-Methyloxy-5-fluorobenzyl bromide | SCHEMBL1663130 | DTXSID60602584 | 2-Methoxy-5-Fluorobenzyl Bromide | LXUGHXUXEMUEKR-UH |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzyl halides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzyl bromides |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Anisoles Fluorobenzenes Alkyl aryl ethers Aryl fluorides Organofluorides Organobromides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Benzyl bromide - Phenol ether - Alkyl aryl ether - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Ether - Organofluoride - Organooxygen compound - Alkyl bromide - Organic oxygen compound - Hydrocarbon derivative - Alkyl halide - Organohalogen compound - Organobromide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzyl bromides. These are organic compounds containing a benzene skeleton substituted with a bromomethyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504768891 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768891 |
| IUPAC Name | 2-(bromomethyl)-4-fluoro-1-methoxybenzene |
| INCHI | InChI=1S/C8H8BrFO/c1-11-8-3-2-7(10)4-6(8)5-9/h2-4H,5H2,1H3 |
| InChIKey | LXUGHXUXEMUEKR-UHFFFAOYSA-N |
| Smiles | COC1=C(C=C(C=C1)F)CBr |
| Isomeric SMILES | COC1=C(C=C(C=C1)F)CBr |
| Molecular Weight | 219.05 |
| Reaxy-Rn | 14402843 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14402843&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 23, 2024 | B194667 | |
| Certificate of Analysis | Oct 23, 2024 | B194667 | |
| Certificate of Analysis | Oct 23, 2024 | B194667 | |
| Certificate of Analysis | Oct 23, 2024 | B194667 | |
| Certificate of Analysis | Oct 23, 2024 | B194667 |
| Melt Point(°C) | 58-62℃ |
|---|---|
| Molecular Weight | 219.050 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 217.974 Da |
| Monoisotopic Mass | 217.974 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 121.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |