Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B183758-250mg
|
250mg |
3
|
$24.90
|
|
|
B183758-1g
|
1g |
3
|
$45.90
|
|
|
B183758-5g
|
5g |
3
|
$120.90
|
|
|
B183758-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$217.90
|
|
|
B183758-25g
|
25g |
2
|
$366.90
|
|
|
B183758-100g
|
100g |
2
|
$1,254.90
|
|
| Synonyms | 2-Bromo-1,1-dimethoxypropane | 33170-72-8 | 2-Bromo-1,1-dimethoxy-propane | MFCD11505877 | Propane, 2-bromo-1,1-dimethoxy- | SCHEMBL1674231 | DTXSID50485181 | HFTQXLCZRCQAAX-UHFFFAOYSA-N | bromopropionaldehyde dimethyl acetal | AC5914 | 2-bromopropionaldehyde dimethyl acetal |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Acetals |
| Alternative Parents | Organobromides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Acetal - Hydrocarbon derivative - Organobromide - Organohalogen compound - Alkyl halide - Alkyl bromide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as acetals. These are compounds having the structure R2C(OR')2 ( R' not Hydrogen) and thus diethers of geminal diols. Originally, the term was confined to derivatives of aldehydes (one R = H), but it now applies equally to derivatives of ketones (neither R = H ). Mixed acetals have different R' groups. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504767041 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767041 |
| IUPAC Name | 2-bromo-1,1-dimethoxypropane |
| INCHI | InChI=1S/C5H11BrO2/c1-4(6)5(7-2)8-3/h4-5H,1-3H3 |
| InChIKey | HFTQXLCZRCQAAX-UHFFFAOYSA-N |
| Smiles | CC(C(OC)OC)Br |
| Isomeric SMILES | CC(C(OC)OC)Br |
| Molecular Weight | 183.04 |
| Reaxy-Rn | 1697636 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1697636&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 05, 2022 | B183758 | |
| Certificate of Analysis | Sep 05, 2022 | B183758 | |
| Certificate of Analysis | Sep 05, 2022 | B183758 | |
| Certificate of Analysis | Sep 05, 2022 | B183758 | |
| Certificate of Analysis | Sep 05, 2022 | B183758 | |
| Certificate of Analysis | Sep 05, 2022 | B183758 |
| Molecular Weight | 183.040 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 181.994 Da |
| Monoisotopic Mass | 181.994 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 54.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |