Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A588639-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$23.90
|
|
|
A588639-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$44.90
|
|
|
A588639-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$78.90
|
|
| Synonyms | 3-Oxa-8-azabicyclo(3,2,1)octane | 4,6-Dibromo-o-toluidine | 2,4-dibromo-6-methylphenylamine | 2-Amino-3,5-dibromotoluene; 4,6-Dibromo-o-toluidine | SY064169 | 3,5-dibromo-2-aminotoluene | BCP19337 | DTXSID30332548 | MFCD00735681 | SCHEMBL109929 | A19643 | |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Protected from light,Desiccated |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Toluenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminotoluenes |
| Alternative Parents | 2-bromoanilines Bromobenzenes Aryl bromides Primary amines Organopnictogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 2-bromoaniline - Aniline or substituted anilines - Aminotoluene - Bromobenzene - Halobenzene - Aryl halide - Aryl bromide - Organic nitrogen compound - Primary amine - Organonitrogen compound - Organobromide - Organohalogen compound - Amine - Organopnictogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminotoluenes. These are organic aromatic compounds containing a benzene that carries a single methyl group and one amino group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,4-dibromo-6-methylaniline |
|---|---|
| INCHI | InChI=1S/C7H7Br2N/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,10H2,1H3 |
| InChIKey | LOOOTYOQFFOBCI-UHFFFAOYSA-N |
| Smiles | CC1=CC(=CC(=C1N)Br)Br |
| Isomeric SMILES | CC1=CC(=CC(=C1N)Br)Br |
| Molecular Weight | 264.948 |
| Reaxy-Rn | 2717135 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2717135&ln= |
| Melt Point(°C) | 45-46° |
|---|---|
| Molecular Weight | 264.940 g/mol |
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 264.892 Da |
| Monoisotopic Mass | 262.895 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 118.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |