Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A633861-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$304.90
|
|
|
A633861-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,369.90
|
|
| Synonyms | SCHEMBL906308 | Adamantane-2-methanamine | P20544 | PS-18058 | AKOS000177582 | AKOS006238831 | (ADAMANTAN-2-YL)METHANAMINE | 1-[(1R,3R,5R,7R)-ADAMANTAN-2-YL]METHANAMINE | 2-adamantylmethanamine | MFCD02632265 | Tricyclo[3.3.1.13,7]decane-2-methanamine | A |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Primary amines |
| Direct Parent | Monoalkylamines |
| Alternative Parents | Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Organopnictogen compound - Hydrocarbon derivative - Primary aliphatic amine - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as monoalkylamines. These are organic compounds containing an primary aliphatic amine group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-adamantylmethanamine |
|---|---|
| INCHI | InChI=1S/C11H19N/c12-6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6,12H2 |
| InChIKey | UIIZRVWVFJSCHN-UHFFFAOYSA-N |
| Smiles | C1C2CC3CC1CC(C2)C3CN |
| Isomeric SMILES | C1C2CC3CC1CC(C2)C3CN |
| Alternate CAS | 42067-67-4 |
| PubChem CID | 303813 |
| NSC Number | 193494 |
| Molecular Weight | 165.270 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 165.152 Da |
| Monoisotopic Mass | 165.152 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 159.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |