Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D187700-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$859.90
|
|
|
D187700-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,941.90
|
|
Discover 2,6-Dichloropyridine-4-methylamine hydrochloride by Aladdin Scientific in 98% for only $859.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2,6-Dichloropyridine-4-methylamine | 88579-63-9 | (2,6-dichloropyridin-4-yl)methanamine | MFCD06212867 | 2,6-Dichloropyridine-4-methylamine hydrochloride | 4-(Aminomethyl)-2,6-dichloropyridine | 4-Pyridinemethanamine, 2,6-dichloro- | SCHEMBL855313 | DTXSID20465379 | LCVQJX |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Polyhalopyridines |
| Alternative Parents | Aralkylamines 2-halopyridines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organochlorides Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - 2-halopyridine - Aralkylamine - Aryl chloride - Aryl halide - Heteroaromatic compound - Azacycle - Amine - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Primary aliphatic amine - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polyhalopyridines. These are organic compounds containing a pyridine ring substituted at two or more positions by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2,6-dichloropyridin-4-yl)methanamine |
|---|---|
| INCHI | InChI=1S/C6H6Cl2N2/c7-5-1-4(3-9)2-6(8)10-5/h1-2H,3,9H2 |
| InChIKey | LCVQJXXKYFOSGH-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(N=C1Cl)Cl)CN |
| Isomeric SMILES | C1=C(C=C(N=C1Cl)Cl)CN |
| Molecular Weight | 213.5 |
| Reaxy-Rn | 120979 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=120979&ln= |
| Molecular Weight | 177.030 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 175.991 Da |
| Monoisotopic Mass | 175.991 Da |
| Topological Polar Surface Area | 38.900 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 99.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |