Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D196136-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$70.90
|
|
| Synonyms | CS-M0699 | 2,6-Dibromo-4-nitro-pyridin N-oxide | Pyridine, 2,6-dibromo-4-nitro-, 1-oxide | 2,6-dibromo-4-nitropyridine1-oxide | 2,6-dibromo-4-nitropyridine 1-oxide | J-400205 | AKOS005216857 | FT-0710326 | SB55113 | SCHEMBL782341 | 2,6-Dibromo-4-nitro-1-o |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Class | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | Polyhalopyridines 2-halopyridines Pyridinium derivatives Aryl bromides Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organonitrogen compounds Organobromides Organic salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Polyhalopyridine - 2-halopyridine - Aryl bromide - Aryl halide - Pyridine - Pyridinium - Heteroaromatic compound - Organic oxoazanium - Azacycle - Organoheterocyclic compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organic oxygen compound - Organic salt - Hydrocarbon derivative - Organonitrogen compound - Organobromide - Organic oxide - Organohalogen compound - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,6-dibromo-4-nitro-1-oxidopyridin-1-ium |
|---|---|
| INCHI | InChI=1S/C5H2Br2N2O3/c6-4-1-3(9(11)12)2-5(7)8(4)10/h1-2H |
| InChIKey | MJEDSUKRJRIBKE-UHFFFAOYSA-N |
| Smiles | C1=C(C=C([N+](=C1Br)[O-])Br)[N+](=O)[O-] |
| Isomeric SMILES | C1=C(C=C([N+](=C1Br)[O-])Br)[N+](=O)[O-] |
| Molecular Weight | 297.9 |
| Reaxy-Rn | 12695 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=12695&ln= |
| Molecular Weight | 297.890 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 297.841 Da |
| Monoisotopic Mass | 295.843 Da |
| Topological Polar Surface Area | 71.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 174.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |